C31H29N5O4S — CID 136666746
2-[11-[[5-(1,3-benzothiazol-2-yl)-2-hydroxy-3-methoxyphenyl]methyl]-3,11,17,18-tetrazatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaen-3-yl]acetic acid (PubChem CID 136666746) has the molecular formula C31H29N5O4S and a molecular weight of 567.67 g/mol. Its IUPAC name is 2-[11-[[5-(1,3-benzothiazol-2-yl)-2-hydroxy-3-methoxyphenyl]methyl]-3,11,17,18-tetrazatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaen-3-yl]acetic acid.
| Compound Name | 2-[11-[[5-(1,3-benzothiazol-2-yl)-2-hydroxy-3-methoxyphenyl]methyl]-3,11,17,18-tetrazatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaen-3-yl]acetic acid |
|---|---|
| PubChem CID | 136666746 |
| Molecular Formula | C31H29N5O4S |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | 2-[11-[[5-(1,3-benzothiazol-2-yl)-2-hydroxy-3-methoxyphenyl]methyl]-3,11,17,18-tetrazatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaen-3-yl]acetic acid |
| SMILES | COc1cc(-c2nc3ccccc3s2)cc(CN2Cc3cccc(n3)CN(CC(=O)O)Cc3cccc(n3)C2)c1O |
| InChI | InChI=1S/C31H29N5O4S/c1-40-27-13-20(31-34-26-10-2-3-11-28(26)41-31)12-21(30(27)39)14-35-15-22-6-4-8-24(32-22)17-36(19-29(37)38)18-25-9-5-7-23(16-35)33-25/h2-13,39H,14-19H2,1H3,(H,37,38) |
| InChIKey | NCAQPQWLZSGEHH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|