C15H22N4O — CID 136666775
N-(2-methoxyethyl)spiro[1,4-dihydroquinoxaline-3,3'-piperidine]-2-imine (PubChem CID 136666775) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is N-(2-methoxyethyl)spiro[1,4-dihydroquinoxaline-3,3'-piperidine]-2-imine.
| Compound Name | N-(2-methoxyethyl)spiro[1,4-dihydroquinoxaline-3,3'-piperidine]-2-imine |
|---|---|
| PubChem CID | 136666775 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | N-(2-methoxyethyl)spiro[1,4-dihydroquinoxaline-3,3'-piperidine]-2-imine |
| SMILES | COCC/N=C1\Nc2ccccc2NC12CCCNC2 |
| InChI | InChI=1S/C15H22N4O/c1-20-10-9-17-14-15(7-4-8-16-11-15)19-13-6-3-2-5-12(13)18-14/h2-3,5-6,16,19H,4,7-11H2,1H3,(H,17,18) |
| InChIKey | KTDIJQBLCHBJAE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 57.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|