C17H25N5O — CID 136666842
1-(3-tert-butyliminospiro[1,4-dihydropyrido[2,3-b]pyrazine-2,3'-piperidine]-1'-yl)ethanone (PubChem CID 136666842) has the molecular formula C17H25N5O and a molecular weight of 315.42 g/mol. Its IUPAC name is 1-(3-tert-butyliminospiro[1,4-dihydropyrido[2,3-b]pyrazine-2,3'-piperidine]-1'-yl)ethanone.
| Compound Name | 1-(3-tert-butyliminospiro[1,4-dihydropyrido[2,3-b]pyrazine-2,3'-piperidine]-1'-yl)ethanone |
|---|---|
| PubChem CID | 136666842 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 1-(3-tert-butyliminospiro[1,4-dihydropyrido[2,3-b]pyrazine-2,3'-piperidine]-1'-yl)ethanone |
| SMILES | CC(=O)N1CCCC2(C1)Nc1cccnc1N/C2=N\C(C)(C)C |
| InChI | InChI=1S/C17H25N5O/c1-12(23)22-10-6-8-17(11-22)15(21-16(2,3)4)19-14-13(20-17)7-5-9-18-14/h5,7,9,20H,6,8,10-11H2,1-4H3,(H,18,19,21) |
| InChIKey | CLIVNUJDJHLYFY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|