C19H28N4O3 — CID 136666855
3-methoxy-1-[2-(2-methoxyethylimino)spiro[4,5-dihydro-1H-1,4-benzodiazepine-3,3'-pyrrolidine]-1'-yl]propan-1-one (PubChem CID 136666855) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is 3-methoxy-1-[2-(2-methoxyethylimino)spiro[4,5-dihydro-1H-1,4-benzodiazepine-3,3'-pyrrolidine]-1'-yl]propan-1-one.
| Compound Name | 3-methoxy-1-[2-(2-methoxyethylimino)spiro[4,5-dihydro-1H-1,4-benzodiazepine-3,3'-pyrrolidine]-1'-yl]propan-1-one |
|---|---|
| PubChem CID | 136666855 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 3-methoxy-1-[2-(2-methoxyethylimino)spiro[4,5-dihydro-1H-1,4-benzodiazepine-3,3'-pyrrolidine]-1'-yl]propan-1-one |
| SMILES | COCC/N=C1\Nc2ccccc2CNC12CCN(C(=O)CCOC)C2 |
| InChI | InChI=1S/C19H28N4O3/c1-25-11-7-17(24)23-10-8-19(14-23)18(20-9-12-26-2)22-16-6-4-3-5-15(16)13-21-19/h3-6,21H,7-14H2,1-2H3,(H,20,22) |
| InChIKey | YIKHUMJQXDRHPP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|