About N-[1-[(4,4-dimethyl-1,3-thiazolidin-2-ylidene)amino]propan-2-yl]-N-methylcyclopropanamine
N-[1-[(4,4-dimethyl-1,3-thiazolidin-2-ylidene)amino]propan-2-yl]-N-methylcyclopropanamine (PubChem CID 136666975) has the molecular formula C12H23N3S
and a molecular weight of 241.40 g/mol. Its IUPAC name is N-[1-[(4,4-dimethyl-1,3-thiazolidin-2-ylidene)amino]propan-2-yl]-N-methylcyclopropanamine.
Molecular Properties
| Compound Name | N-[1-[(4,4-dimethyl-1,3-thiazolidin-2-ylidene)amino]propan-2-yl]-N-methylcyclopropanamine |
| PubChem CID | 136666975 |
| Molecular Formula | C12H23N3S |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | N-[1-[(4,4-dimethyl-1,3-thiazolidin-2-ylidene)amino]propan-2-yl]-N-methylcyclopropanamine |
| SMILES | CC(C/N=C1/NC(C)(C)CS1)N(C)C1CC1 |
| InChI | InChI=1S/C12H23N3S/c1-9(15(4)10-5-6-10)7-13-11-14-12(2,3)8-16-11/h9-10H,5-8H2,1-4H3,(H,13,14) |
| InChIKey | PZVJMXNXBYSYII-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[1-[(4,4-dimethyl-1,3-thiazolidin-2-ylidene)amino]propan-2-yl]-N-methylcyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(4,4-dimethyl-1,3-thiazolidin-2-ylidene)amino]propan-2-yl]-N-methylcyclopropanamine?
The IUPAC name of N-[1-[(4,4-dimethyl-1,3-thiazolidin-2-ylidene)amino]propan-2-yl]-N-methylcyclopropanamine (CID 136666975) is N-[1-[(4,4-dimethyl-1,3-thiazolidin-2-ylidene)amino]propan-2-yl]-N-methylcyclopropanamine.
What is the SMILES notation for N-[1-[(4,4-dimethyl-1,3-thiazolidin-2-ylidene)amino]propan-2-yl]-N-methylcyclopropanamine?
The canonical SMILES for N-[1-[(4,4-dimethyl-1,3-thiazolidin-2-ylidene)amino]propan-2-yl]-N-methylcyclopropanamine is CC(C/N=C1/NC(C)(C)CS1)N(C)C1CC1.
What is the InChIKey of N-[1-[(4,4-dimethyl-1,3-thiazolidin-2-ylidene)amino]propan-2-yl]-N-methylcyclopropanamine?
The InChIKey is PZVJMXNXBYSYII-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3S/c1-9(15(4)10-5-6-10)7-13-11-14-12(2,3)8-16-11/h9-10H,5-8H2,1-4H3,(H,13,14).
What are the key properties of N-[1-[(4,4-dimethyl-1,3-thiazolidin-2-ylidene)amino]propan-2-yl]-N-methylcyclopropanamine?
N-[1-[(4,4-dimethyl-1,3-thiazolidin-2-ylidene)amino]propan-2-yl]-N-methylcyclopropanamine has a molecular weight of 241.40 g/mol, XLogP of 1.94, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(4,4-dimethyl-1,3-thiazolidin-2-ylidene)amino]propan-2-yl]-N-methylcyclopropanamine is sourced from PubChem (CID 136666975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).