C16H22N2OS — CID 136667028
(6aS,10aR)-6,6,9-trimethyl-3-methylsulfanyl-2,5,6a,7,8,10a-hexahydrobenzo[f]quinazolin-1-one (PubChem CID 136667028) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is (6aS,10aR)-6,6,9-trimethyl-3-methylsulfanyl-2,5,6a,7,8,10a-hexahydrobenzo[f]quinazolin-1-one.
| Compound Name | (6aS,10aR)-6,6,9-trimethyl-3-methylsulfanyl-2,5,6a,7,8,10a-hexahydrobenzo[f]quinazolin-1-one |
|---|---|
| PubChem CID | 136667028 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (6aS,10aR)-6,6,9-trimethyl-3-methylsulfanyl-2,5,6a,7,8,10a-hexahydrobenzo[f]quinazolin-1-one |
| SMILES | CSc1nc2c(c(=O)[nH]1)[C@@H]1C=C(C)CC[C@@H]1C(C)(C)C2 |
| InChI | InChI=1S/C16H22N2OS/c1-9-5-6-11-10(7-9)13-12(8-16(11,2)3)17-15(20-4)18-14(13)19/h7,10-11H,5-6,8H2,1-4H3,(H,17,18,19)/t10-,11+/m1/s1 |
| InChIKey | HFVQGXYSGIZIDB-MNOVXSKESA-N |
| XLogP | 3.51 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|