About N-benzyl-6-methylidenecyclohexa-1,4-dien-1-amine
N-benzyl-6-methylidenecyclohexa-1,4-dien-1-amine (PubChem CID 136669247) has the molecular formula C14H14N+
and a molecular weight of 196.27 g/mol. Its IUPAC name is N-benzyl-6-methylidenecyclohexa-1,4-dien-1-amine.
Molecular Properties
| Compound Name | N-benzyl-6-methylidenecyclohexa-1,4-dien-1-amine |
| PubChem CID | 136669247 |
| Molecular Formula | C14H14N+ |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | N-benzyl-6-methylidenecyclohexa-1,4-dien-1-amine |
| SMILES | [H]/[C+]=C1\C=CCC=C1NCc1ccccc1 |
| InChI | InChI=1S/C14H14N/c1-12-7-5-6-10-14(12)15-11-13-8-3-2-4-9-13/h1-5,7-10,15H,6,11H2/q+1 |
| InChIKey | URCDLLPIWNESFR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-6-methylidenecyclohexa-1,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-6-methylidenecyclohexa-1,4-dien-1-amine?
The IUPAC name of N-benzyl-6-methylidenecyclohexa-1,4-dien-1-amine (CID 136669247) is N-benzyl-6-methylidenecyclohexa-1,4-dien-1-amine.
What is the SMILES notation for N-benzyl-6-methylidenecyclohexa-1,4-dien-1-amine?
The canonical SMILES for N-benzyl-6-methylidenecyclohexa-1,4-dien-1-amine is [H]/[C+]=C1\C=CCC=C1NCc1ccccc1.
What is the InChIKey of N-benzyl-6-methylidenecyclohexa-1,4-dien-1-amine?
The InChIKey is URCDLLPIWNESFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N/c1-12-7-5-6-10-14(12)15-11-13-8-3-2-4-9-13/h1-5,7-10,15H,6,11H2/q+1.
What are the key properties of N-benzyl-6-methylidenecyclohexa-1,4-dien-1-amine?
N-benzyl-6-methylidenecyclohexa-1,4-dien-1-amine has a molecular weight of 196.27 g/mol, XLogP of 2.98, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-6-methylidenecyclohexa-1,4-dien-1-amine is sourced from PubChem (CID 136669247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).