About CID 136670518
CID 136670518 (PubChem CID 136670518) has the molecular formula C22H24S2Si2
and a molecular weight of 408.74 g/mol.
Molecular Properties
| Compound Name | CID 136670518 |
| PubChem CID | 136670518 |
| Molecular Formula | C22H24S2Si2 |
| Molecular Weight | 408.74 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | — |
| SMILES | C[Si](C)/C=C/c1ccc(-c2ccc(-c3ccc(/C=C/[Si](C)C)s3)cc2)s1 |
| InChI | InChI=1S/C22H24S2Si2/c1-25(2)15-13-19-9-11-21(23-19)17-5-7-18(8-6-17)22-12-10-20(24-22)14-16-26(3)4/h5-16H,1-4H3/b15-13+,16-14+ |
| InChIKey | HVYPELAMHJAHJK-WXUKJITCSA-N |
| XLogP | 7.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.74 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 136670518 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136670518?
The IUPAC name of CID 136670518 (CID 136670518) is not available.
What is the SMILES notation for CID 136670518?
The canonical SMILES for CID 136670518 is C[Si](C)/C=C/c1ccc(-c2ccc(-c3ccc(/C=C/[Si](C)C)s3)cc2)s1.
What is the InChIKey of CID 136670518?
The InChIKey is HVYPELAMHJAHJK-WXUKJITCSA-N. The full InChI is InChI=1S/C22H24S2Si2/c1-25(2)15-13-19-9-11-21(23-19)17-5-7-18(8-6-17)22-12-10-20(24-22)14-16-26(3)4/h5-16H,1-4H3/b15-13+,16-14+.
What are the key properties of CID 136670518?
CID 136670518 has a molecular weight of 408.74 g/mol, XLogP of 7.76, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136670518 is sourced from PubChem (CID 136670518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).