C23H26N6O2 — CID 136671359
4-[(5-oxo-4H-1,2,4-triazin-3-yl)amino]-N-[1-(4-piperidin-1-ylphenyl)ethyl]benzamide (PubChem CID 136671359) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 4-[(5-oxo-4H-1,2,4-triazin-3-yl)amino]-N-[1-(4-piperidin-1-ylphenyl)ethyl]benzamide.
| Compound Name | 4-[(5-oxo-4H-1,2,4-triazin-3-yl)amino]-N-[1-(4-piperidin-1-ylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 136671359 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 4-[(5-oxo-4H-1,2,4-triazin-3-yl)amino]-N-[1-(4-piperidin-1-ylphenyl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1ccc(Nc2nncc(=O)[nH]2)cc1)c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C23H26N6O2/c1-16(17-7-11-20(12-8-17)29-13-3-2-4-14-29)25-22(31)18-5-9-19(10-6-18)26-23-27-21(30)15-24-28-23/h5-12,15-16H,2-4,13-14H2,1H3,(H,25,31)(H2,26,27,28,30) |
| InChIKey | WYRQGXWZGMQUNK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|