C24H22FN3 — CID 136671416
(2S,4R)-4-(4-ethylphenyl)-2-(4-fluorophenyl)-1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazole (PubChem CID 136671416) has the molecular formula C24H22FN3 and a molecular weight of 371.46 g/mol. Its IUPAC name is (2S,4R)-4-(4-ethylphenyl)-2-(4-fluorophenyl)-1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazole.
| Compound Name | (2S,4R)-4-(4-ethylphenyl)-2-(4-fluorophenyl)-1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 136671416 |
| Molecular Formula | C24H22FN3 |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | (2S,4R)-4-(4-ethylphenyl)-2-(4-fluorophenyl)-1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazole |
| SMILES | CCc1ccc([C@H]2C[C@@H](c3ccc(F)cc3)Nc3nc4ccccc4n32)cc1 |
| InChI | InChI=1S/C24H22FN3/c1-2-16-7-9-18(10-8-16)23-15-21(17-11-13-19(25)14-12-17)27-24-26-20-5-3-4-6-22(20)28(23)24/h3-14,21,23H,2,15H2,1H3,(H,26,27)/t21-,23+/m0/s1 |
| InChIKey | YILJBYRSIULZSG-JTHBVZDNSA-N |
| XLogP | 5.88 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |