C40H58I4N2O2 — CID 136671755
4-(1,7-diiodoheptan-4-yl)-2-[[(1S,2S)-2-[[5-(1,7-diiodoheptan-4-yl)-2-hydroxy-3-propan-2-ylphenyl]methylideneamino]cyclohexyl]iminomethyl]-6-propan-2-ylphenol (PubChem CID 136671755) has the molecular formula C40H58I4N2O2 and a molecular weight of 1106.53 g/mol. Its IUPAC name is 4-(1,7-diiodoheptan-4-yl)-2-[[(1S,2S)-2-[[5-(1,7-diiodoheptan-4-yl)-2-hydroxy-3-propan-2-ylphenyl]methylideneamino]cyclohexyl]iminomethyl]-6-propan-2-ylphenol.
| Compound Name | 4-(1,7-diiodoheptan-4-yl)-2-[[(1S,2S)-2-[[5-(1,7-diiodoheptan-4-yl)-2-hydroxy-3-propan-2-ylphenyl]methylideneamino]cyclohexyl]iminomethyl]-6-propan-2-ylphenol |
|---|---|
| PubChem CID | 136671755 |
| Molecular Formula | C40H58I4N2O2 |
| Molecular Weight | 1106.53 g/mol |
| Exact Mass | 1106.07 |
| IUPAC Name | 4-(1,7-diiodoheptan-4-yl)-2-[[(1S,2S)-2-[[5-(1,7-diiodoheptan-4-yl)-2-hydroxy-3-propan-2-ylphenyl]methylideneamino]cyclohexyl]iminomethyl]-6-propan-2-ylphenol |
| SMILES | CC(C)c1cc(C(CCCI)CCCI)cc(/C=N/[C@H]2CCCC[C@@H]2/N=C/c2cc(C(CCCI)CCCI)cc(C(C)C)c2O)c1O |
| InChI | InChI=1S/C40H58I4N2O2/c1-27(2)35-23-31(29(11-7-17-41)12-8-18-42)21-33(39(35)47)25-45-37-15-5-6-16-38(37)46-26-34-22-32(24-36(28(3)4)40(34)48)30(13-9-19-43)14-10-20-44/h21-30,37-38,47-48H,5-20H2,1-4H3/b45-25+,46-26+/t37-,38-/m0/s1 |
| InChIKey | TZUSLBVPJDJQKS-SMFOKSTFSA-N |
| XLogP | 13.22 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1106.53 |
| LogP ≤ 5 | 13.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|