C10H16N4O2 — CID 136671884
3-methyl-3-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)amino]butanamide (PubChem CID 136671884) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-methyl-3-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)amino]butanamide.
| Compound Name | 3-methyl-3-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)amino]butanamide |
|---|---|
| PubChem CID | 136671884 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 3-methyl-3-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)amino]butanamide |
| SMILES | Cc1nc(NC(C)(C)CC(N)=O)cc(=O)[nH]1 |
| InChI | InChI=1S/C10H16N4O2/c1-6-12-8(4-9(16)13-6)14-10(2,3)5-7(11)15/h4H,5H2,1-3H3,(H2,11,15)(H2,12,13,14,16) |
| InChIKey | PWYXBMMKLOFWAG-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |