C14H15FN4OS — CID 136672004
4-amino-2-[2-[(cyclopropylamino)methyl]-3-fluorophenyl]sulfanyl-1H-pyrimidin-6-one (PubChem CID 136672004) has the molecular formula C14H15FN4OS and a molecular weight of 306.37 g/mol. Its IUPAC name is 4-amino-2-[2-[(cyclopropylamino)methyl]-3-fluorophenyl]sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-[2-[(cyclopropylamino)methyl]-3-fluorophenyl]sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136672004 |
| Molecular Formula | C14H15FN4OS |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-amino-2-[2-[(cyclopropylamino)methyl]-3-fluorophenyl]sulfanyl-1H-pyrimidin-6-one |
| SMILES | Nc1cc(=O)[nH]c(Sc2cccc(F)c2CNC2CC2)n1 |
| InChI | InChI=1S/C14H15FN4OS/c15-10-2-1-3-11(9(10)7-17-8-4-5-8)21-14-18-12(16)6-13(20)19-14/h1-3,6,8,17H,4-5,7H2,(H3,16,18,19,20) |
| InChIKey | HIXGHCQCKDSDPT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |