C14H24N4O — CID 136672023
4-[(2-amino-1-cyclopentylethyl)amino]-2-propan-2-yl-1H-pyrimidin-6-one (PubChem CID 136672023) has the molecular formula C14H24N4O and a molecular weight of 264.37 g/mol. Its IUPAC name is 4-[(2-amino-1-cyclopentylethyl)amino]-2-propan-2-yl-1H-pyrimidin-6-one.
| Compound Name | 4-[(2-amino-1-cyclopentylethyl)amino]-2-propan-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136672023 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 4-[(2-amino-1-cyclopentylethyl)amino]-2-propan-2-yl-1H-pyrimidin-6-one |
| SMILES | CC(C)c1nc(NC(CN)C2CCCC2)cc(=O)[nH]1 |
| InChI | InChI=1S/C14H24N4O/c1-9(2)14-17-12(7-13(19)18-14)16-11(8-15)10-5-3-4-6-10/h7,9-11H,3-6,8,15H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | MCUWYQTUJMUXCD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |