C12H15N7 — CID 136672030
3-(2-methylpiperidin-4-yl)-9H-[1,2,4]triazolo[3,4-f]purine (PubChem CID 136672030) has the molecular formula C12H15N7 and a molecular weight of 257.30 g/mol. Its IUPAC name is 3-(2-methylpiperidin-4-yl)-9H-[1,2,4]triazolo[3,4-f]purine.
| Compound Name | 3-(2-methylpiperidin-4-yl)-9H-[1,2,4]triazolo[3,4-f]purine |
|---|---|
| PubChem CID | 136672030 |
| Molecular Formula | C12H15N7 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 3-(2-methylpiperidin-4-yl)-9H-[1,2,4]triazolo[3,4-f]purine |
| SMILES | CC1CC(c2nnc3c4[nH]cnc4ncn23)CCN1 |
| InChI | InChI=1S/C12H15N7/c1-7-4-8(2-3-13-7)11-17-18-12-9-10(15-5-14-9)16-6-19(11)12/h5-8,13H,2-4H2,1H3,(H,14,15) |
| InChIKey | RHOQSFIOULKLBF-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |