C51H36N4O8 — CID 136672669
4-[10,15,20-tris(4-methoxycarbonylphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid (PubChem CID 136672669) has the molecular formula C51H36N4O8 and a molecular weight of 832.87 g/mol. Its IUPAC name is 4-[10,15,20-tris(4-methoxycarbonylphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid.
| Compound Name | 4-[10,15,20-tris(4-methoxycarbonylphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 136672669 |
| Molecular Formula | C51H36N4O8 |
| Molecular Weight | 832.87 g/mol |
| Exact Mass | 832.25 |
| IUPAC Name | 4-[10,15,20-tris(4-methoxycarbonylphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
| SMILES | COC(=O)c1ccc(-c2c3nc(c(-c4ccc(C(=O)OC)cc4)c4ccc([nH]4)c(-c4ccc(C(=O)OC)cc4)c4nc(c(-c5ccc(C(=O)O)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C51H36N4O8/c1-61-49(58)33-14-6-29(7-15-33)45-38-22-20-36(52-38)44(28-4-12-32(13-5-28)48(56)57)37-21-23-39(53-37)46(30-8-16-34(17-9-30)50(59)62-2)41-25-27-43(55-41)47(42-26-24-40(45)54-42)31-10-18-35(19-11-31)51(60)63-3/h4-27,52,55H,1-3H3,(H,56,57)/b44-36-,44-37-,45-38-,45-40-,46-39-,46-41-,47-42-,47-43- |
| InChIKey | XTVTXFFLPYHBNO-ZQANTMHOSA-N |
| XLogP | 10.38 |
| TPSA | 173.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.87 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|