C19H20N4OS — CID 136673538
2-pyridin-3-yl-4-[(3R)-1-(thiophen-3-ylmethyl)piperidin-3-yl]-1H-pyrimidin-6-one (PubChem CID 136673538) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is 2-pyridin-3-yl-4-[(3R)-1-(thiophen-3-ylmethyl)piperidin-3-yl]-1H-pyrimidin-6-one.
| Compound Name | 2-pyridin-3-yl-4-[(3R)-1-(thiophen-3-ylmethyl)piperidin-3-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136673538 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-pyridin-3-yl-4-[(3R)-1-(thiophen-3-ylmethyl)piperidin-3-yl]-1H-pyrimidin-6-one |
| SMILES | O=c1cc([C@@H]2CCCN(Cc3ccsc3)C2)nc(-c2cccnc2)[nH]1 |
| InChI | InChI=1S/C19H20N4OS/c24-18-9-17(21-19(22-18)15-3-1-6-20-10-15)16-4-2-7-23(12-16)11-14-5-8-25-13-14/h1,3,5-6,8-10,13,16H,2,4,7,11-12H2,(H,21,22,24)/t16-/m1/s1 |
| InChIKey | IOLBLEZOBLKVAP-MRXNPFEDSA-N |
| XLogP | 3.27 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |