C16H22F3N5O2 — CID 136673672
[(3R)-oxolan-3-yl]-[4-[(5S,7R)-7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone (PubChem CID 136673672) has the molecular formula C16H22F3N5O2 and a molecular weight of 373.38 g/mol. Its IUPAC name is [(3R)-oxolan-3-yl]-[4-[(5S,7R)-7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone.
| Compound Name | [(3R)-oxolan-3-yl]-[4-[(5S,7R)-7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 136673672 |
| Molecular Formula | C16H22F3N5O2 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | [(3R)-oxolan-3-yl]-[4-[(5S,7R)-7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone |
| SMILES | O=C([C@@H]1CCOC1)N1CCC([C@@H]2C[C@H](C(F)(F)F)n3ncnc3N2)CC1 |
| InChI | InChI=1S/C16H22F3N5O2/c17-16(18,19)13-7-12(22-15-20-9-21-24(13)15)10-1-4-23(5-2-10)14(25)11-3-6-26-8-11/h9-13H,1-8H2,(H,20,21,22)/t11-,12+,13-/m1/s1 |
| InChIKey | HXIXQIIYFJWBGN-FRRDWIJNSA-N |
| XLogP | 1.84 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |