C13H22N4O3 — CID 136673960
N-[(1S,3R)-3-ethoxy-2,2-diethylcyclobutyl]-5-oxo-1,4-dihydro-1,2,4-triazole-3-carboxamide (PubChem CID 136673960) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is N-[(1S,3R)-3-ethoxy-2,2-diethylcyclobutyl]-5-oxo-1,4-dihydro-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[(1S,3R)-3-ethoxy-2,2-diethylcyclobutyl]-5-oxo-1,4-dihydro-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 136673960 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | N-[(1S,3R)-3-ethoxy-2,2-diethylcyclobutyl]-5-oxo-1,4-dihydro-1,2,4-triazole-3-carboxamide |
| SMILES | CCO[C@@H]1C[C@H](NC(=O)c2n[nH]c(=O)[nH]2)C1(CC)CC |
| InChI | InChI=1S/C13H22N4O3/c1-4-13(5-2)8(7-9(13)20-6-3)14-11(18)10-15-12(19)17-16-10/h8-9H,4-7H2,1-3H3,(H,14,18)(H2,15,16,17,19)/t8-,9+/m0/s1 |
| InChIKey | XBJSZXRODQWNHY-DTWKUNHWSA-N |
| XLogP | 0.81 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |