C18H21N7O2 — CID 136674390
(13R)-13-(1,3,5-trimethylpyrazol-4-yl)-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-15-amine (PubChem CID 136674390) has the molecular formula C18H21N7O2 and a molecular weight of 367.41 g/mol. Its IUPAC name is (13R)-13-(1,3,5-trimethylpyrazol-4-yl)-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-15-amine.
| Compound Name | (13R)-13-(1,3,5-trimethylpyrazol-4-yl)-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-15-amine |
|---|---|
| PubChem CID | 136674390 |
| Molecular Formula | C18H21N7O2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | (13R)-13-(1,3,5-trimethylpyrazol-4-yl)-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-15-amine |
| SMILES | Cc1nn(C)c(C)c1[C@@H]1N=C(N)Nc2nc3cc4c(cc3n21)OCCCO4 |
| InChI | InChI=1S/C18H21N7O2/c1-9-15(10(2)24(3)23-9)16-21-17(19)22-18-20-11-7-13-14(8-12(11)25(16)18)27-6-4-5-26-13/h7-8,16H,4-6H2,1-3H3,(H3,19,20,21,22)/t16-/m1/s1 |
| InChIKey | BUGWQSUQPCYIOR-MRXNPFEDSA-N |
| XLogP | 1.84 |
| TPSA | 104.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |