C10H11N3O2S — CID 136674882
5-(2-hydroxy-5-methoxyphenyl)-2-methyl-1H-1,2,4-triazole-3-thione (PubChem CID 136674882) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is 5-(2-hydroxy-5-methoxyphenyl)-2-methyl-1H-1,2,4-triazole-3-thione.
| Compound Name | 5-(2-hydroxy-5-methoxyphenyl)-2-methyl-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 136674882 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 5-(2-hydroxy-5-methoxyphenyl)-2-methyl-1H-1,2,4-triazole-3-thione |
| SMILES | COc1ccc(O)c(-c2nc(=S)n(C)[nH]2)c1 |
| InChI | InChI=1S/C10H11N3O2S/c1-13-10(16)11-9(12-13)7-5-6(15-2)3-4-8(7)14/h3-5,14H,1-2H3,(H,11,12,16) |
| InChIKey | SGSFHYUYFOPECJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|