C13H21N3O3 — CID 136675576
4-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]-2-propan-2-yl-1H-pyrimidin-6-one (PubChem CID 136675576) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 4-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]-2-propan-2-yl-1H-pyrimidin-6-one.
| Compound Name | 4-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]-2-propan-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136675576 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 4-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]-2-propan-2-yl-1H-pyrimidin-6-one |
| SMILES | CC(C)c1nc(NCC2(O)CCOC2C)cc(=O)[nH]1 |
| InChI | InChI=1S/C13H21N3O3/c1-8(2)12-15-10(6-11(17)16-12)14-7-13(18)4-5-19-9(13)3/h6,8-9,18H,4-5,7H2,1-3H3,(H2,14,15,16,17) |
| InChIKey | BVJJGEJJAJTCHR-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |