C13H14N6O2 — CID 136675690
6-amino-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]-3H-quinazolin-4-one (PubChem CID 136675690) has the molecular formula C13H14N6O2 and a molecular weight of 286.30 g/mol. Its IUPAC name is 6-amino-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]-3H-quinazolin-4-one.
| Compound Name | 6-amino-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136675690 |
| Molecular Formula | C13H14N6O2 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 6-amino-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]-3H-quinazolin-4-one |
| SMILES | Cc1noc(CCNc2nc3ccc(N)cc3c(=O)[nH]2)n1 |
| InChI | InChI=1S/C13H14N6O2/c1-7-16-11(21-19-7)4-5-15-13-17-10-3-2-8(14)6-9(10)12(20)18-13/h2-3,6H,4-5,14H2,1H3,(H2,15,17,18,20) |
| InChIKey | SKLVVIGWDXEOPH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|