C19H25N3O2 — CID 136676375
(1R,10R)-13-[(1S,6S)-bicyclo[4.1.0]heptane-7-carbonyl]-5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one (PubChem CID 136676375) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is (1R,10R)-13-[(1S,6S)-bicyclo[4.1.0]heptane-7-carbonyl]-5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one.
| Compound Name | (1R,10R)-13-[(1S,6S)-bicyclo[4.1.0]heptane-7-carbonyl]-5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one |
|---|---|
| PubChem CID | 136676375 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | (1R,10R)-13-[(1S,6S)-bicyclo[4.1.0]heptane-7-carbonyl]-5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one |
| SMILES | Cc1nc2c(c(=O)[nH]1)C[C@H]1CC[C@H](C2)N1C(=O)C1[C@H]2CCCC[C@H]12 |
| InChI | InChI=1S/C19H25N3O2/c1-10-20-16-9-12-7-6-11(8-15(16)18(23)21-10)22(12)19(24)17-13-4-2-3-5-14(13)17/h11-14,17H,2-9H2,1H3,(H,20,21,23)/t11-,12-,13+,14+/m1/s1 |
| InChIKey | MONFKTNMKMNYNQ-MQYQWHSLSA-N |
| XLogP | 1.97 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |