C25H36N4O3 — CID 136676476
6-[(1R,6R)-bicyclo[4.1.0]heptane-7-carbonyl]-2-[1-(oxan-4-yl)piperidin-4-yl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 136676476) has the molecular formula C25H36N4O3 and a molecular weight of 440.59 g/mol. Its IUPAC name is 6-[(1R,6R)-bicyclo[4.1.0]heptane-7-carbonyl]-2-[1-(oxan-4-yl)piperidin-4-yl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(1R,6R)-bicyclo[4.1.0]heptane-7-carbonyl]-2-[1-(oxan-4-yl)piperidin-4-yl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136676476 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 6-[(1R,6R)-bicyclo[4.1.0]heptane-7-carbonyl]-2-[1-(oxan-4-yl)piperidin-4-yl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=C(C1[C@@H]2CCCC[C@@H]12)N1CCc2nc(C3CCN(C4CCOCC4)CC3)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C25H36N4O3/c30-24-20-15-29(25(31)22-18-3-1-2-4-19(18)22)12-7-21(20)26-23(27-24)16-5-10-28(11-6-16)17-8-13-32-14-9-17/h16-19,22H,1-15H2,(H,26,27,30)/t18-,19-/m1/s1 |
| InChIKey | BQVRWDZNERSIJN-RTBURBONSA-N |
| XLogP | 2.45 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |