C17H19N7 — CID 136678230
N,N-diethyl-4-[(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)diazenyl]aniline (PubChem CID 136678230) has the molecular formula C17H19N7 and a molecular weight of 321.39 g/mol. Its IUPAC name is N,N-diethyl-4-[(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)diazenyl]aniline.
| Compound Name | N,N-diethyl-4-[(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)diazenyl]aniline |
|---|---|
| PubChem CID | 136678230 |
| Molecular Formula | C17H19N7 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | N,N-diethyl-4-[(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)diazenyl]aniline |
| SMILES | CCN(CC)c1ccc(/N=N/c2n[nH]c(-c3cccnc3)n2)cc1 |
| InChI | InChI=1S/C17H19N7/c1-3-24(4-2)15-9-7-14(8-10-15)20-22-17-19-16(21-23-17)13-6-5-11-18-12-13/h5-12H,3-4H2,1-2H3,(H,19,21,23)/b22-20+ |
| InChIKey | KKEZTVNZZVFUAR-LSDHQDQOSA-N |
| XLogP | 4.13 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|