C18H13N5O3S — CID 136679888
9-(4-nitrophenyl)-17-thia-2,12,13,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12-pentaen-15-one (PubChem CID 136679888) has the molecular formula C18H13N5O3S and a molecular weight of 379.40 g/mol. Its IUPAC name is 9-(4-nitrophenyl)-17-thia-2,12,13,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12-pentaen-15-one.
| Compound Name | 9-(4-nitrophenyl)-17-thia-2,12,13,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12-pentaen-15-one |
|---|---|
| PubChem CID | 136679888 |
| Molecular Formula | C18H13N5O3S |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 9-(4-nitrophenyl)-17-thia-2,12,13,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12-pentaen-15-one |
| SMILES | O=c1[nH]nnc2c1sc1nc3c(c(-c4ccc([N+](=O)[O-])cc4)c12)CCCC3 |
| InChI | InChI=1S/C18H13N5O3S/c24-17-16-15(20-22-21-17)14-13(9-5-7-10(8-6-9)23(25)26)11-3-1-2-4-12(11)19-18(14)27-16/h5-8H,1-4H2,(H,20,21,24) |
| InChIKey | OIXAYKDAAILQKT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|