C12H7N4NaO2S2 — CID 136679896
sodium 4,14-dimethyl-12-oxo-8,10-dithia-3,5,13,15-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),3,5,11(16),14-hexaen-6-olate (PubChem CID 136679896) has the molecular formula C12H7N4NaO2S2 and a molecular weight of 326.34 g/mol. Its IUPAC name is sodium 4,14-dimethyl-12-oxo-8,10-dithia-3,5,13,15-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),3,5,11(16),14-hexaen-6-olate.
| Compound Name | sodium 4,14-dimethyl-12-oxo-8,10-dithia-3,5,13,15-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),3,5,11(16),14-hexaen-6-olate |
|---|---|
| PubChem CID | 136679896 |
| Molecular Formula | C12H7N4NaO2S2 |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | sodium 4,14-dimethyl-12-oxo-8,10-dithia-3,5,13,15-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),3,5,11(16),14-hexaen-6-olate |
| SMILES | Cc1nc([O-])c2sc3sc4c(=O)[nH]c(C)nc4c3c2n1.[Na+] |
| InChI | InChI=1S/C12H8N4O2S2.Na/c1-3-13-6-5-7-9(11(18)16-4(2)14-7)20-12(5)19-8(6)10(17)15-3;/h1-2H3,(H,13,15,17)(H,14,16,18);/q;+1/p-1 |
| InChIKey | FDNYYNVMWOBBQU-UHFFFAOYSA-M |
| XLogP | -1.16 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |