C42H25N3O6 — CID 136680233
N-[5-[[5-[[hydroxy(phenyl)methylidene]amino]-9,10-dioxoanthracen-1-yl]amino]-9,10-dioxoanthracen-1-yl]benzenecarboximidic acid (PubChem CID 136680233) has the molecular formula C42H25N3O6 and a molecular weight of 667.68 g/mol. Its IUPAC name is N-[5-[[5-[[hydroxy(phenyl)methylidene]amino]-9,10-dioxoanthracen-1-yl]amino]-9,10-dioxoanthracen-1-yl]benzenecarboximidic acid.
| Compound Name | N-[5-[[5-[[hydroxy(phenyl)methylidene]amino]-9,10-dioxoanthracen-1-yl]amino]-9,10-dioxoanthracen-1-yl]benzenecarboximidic acid |
|---|---|
| PubChem CID | 136680233 |
| Molecular Formula | C42H25N3O6 |
| Molecular Weight | 667.68 g/mol |
| Exact Mass | 667.17 |
| IUPAC Name | N-[5-[[5-[[hydroxy(phenyl)methylidene]amino]-9,10-dioxoanthracen-1-yl]amino]-9,10-dioxoanthracen-1-yl]benzenecarboximidic acid |
| SMILES | O=C1c2cccc(Nc3cccc4c3C(=O)c3cccc(/N=C(\O)c5ccccc5)c3C4=O)c2C(=O)c2cccc(/N=C(\O)c3ccccc3)c21 |
| InChI | InChI=1S/C42H25N3O6/c46-37-27-17-9-21-31(44-41(50)23-11-3-1-4-12-23)35(27)39(48)25-15-7-19-29(33(25)37)43-30-20-8-16-26-34(30)38(47)28-18-10-22-32(36(28)40(26)49)45-42(51)24-13-5-2-6-14-24/h1-22,43H,(H,44,50)(H,45,51) |
| InChIKey | INRJLKFJRQCGOR-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 145.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.68 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|