C61H82F3N7O11 — CID 136680333
bis[2-(3,4-dihexoxyphenyl)ethyl] (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-(2,2,2-trifluoroacetyl)amino]benzoyl]amino]pentanedioate (PubChem CID 136680333) has the molecular formula C61H82F3N7O11 and a molecular weight of 1146.36 g/mol. Its IUPAC name is bis[2-(3,4-dihexoxyphenyl)ethyl] (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-(2,2,2-trifluoroacetyl)amino]benzoyl]amino]pentanedioate.
| Compound Name | bis[2-(3,4-dihexoxyphenyl)ethyl] (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-(2,2,2-trifluoroacetyl)amino]benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 136680333 |
| Molecular Formula | C61H82F3N7O11 |
| Molecular Weight | 1146.36 g/mol |
| Exact Mass | 1145.60 |
| IUPAC Name | bis[2-(3,4-dihexoxyphenyl)ethyl] (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-(2,2,2-trifluoroacetyl)amino]benzoyl]amino]pentanedioate |
| SMILES | CCCCCCOc1ccc(CCOC(=O)CC[C@H](NC(=O)c2ccc(N(Cc3cnc4nc(N)[nH]c(=O)c4n3)C(=O)C(F)(F)F)cc2)C(=O)OCCc2ccc(OCCCCCC)c(OCCCCCC)c2)cc1OCCCCCC |
| InChI | InChI=1S/C61H82F3N7O11/c1-5-9-13-17-33-77-49-28-21-43(39-51(49)79-35-19-15-11-7-3)31-37-81-53(72)30-27-48(58(75)82-38-32-44-22-29-50(78-34-18-14-10-6-2)52(40-44)80-36-20-16-12-8-4)68-56(73)45-23-25-47(26-24-45)71(59(76)61(62,63)64)42-46-41-66-55-54(67-46)57(74)70-60(65)69-55/h21-26,28-29,39-41,48H,5-20,27,30-38,42H2,1-4H3,(H,68,73)(H3,65,66,69,70,74)/t48-/m0/s1 |
| InChIKey | ZZUPECSVUJYIRU-DYVQZXGMSA-N |
| XLogP | 11.68 |
| TPSA | 236.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1146.36 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|