C19H20FN3O2 — CID 136680936
(6aS,9aR)-8-[2-(3-fluorophenyl)acetyl]-2-methyl-5,6,6a,7,9,9a-hexahydro-3H-pyrrolo[3,4-h]quinazolin-4-one (PubChem CID 136680936) has the molecular formula C19H20FN3O2 and a molecular weight of 341.39 g/mol. Its IUPAC name is (6aS,9aR)-8-[2-(3-fluorophenyl)acetyl]-2-methyl-5,6,6a,7,9,9a-hexahydro-3H-pyrrolo[3,4-h]quinazolin-4-one.
| Compound Name | (6aS,9aR)-8-[2-(3-fluorophenyl)acetyl]-2-methyl-5,6,6a,7,9,9a-hexahydro-3H-pyrrolo[3,4-h]quinazolin-4-one |
|---|---|
| PubChem CID | 136680936 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | (6aS,9aR)-8-[2-(3-fluorophenyl)acetyl]-2-methyl-5,6,6a,7,9,9a-hexahydro-3H-pyrrolo[3,4-h]quinazolin-4-one |
| SMILES | Cc1nc2c(c(=O)[nH]1)CC[C@@H]1CN(C(=O)Cc3cccc(F)c3)C[C@H]21 |
| InChI | InChI=1S/C19H20FN3O2/c1-11-21-18-15(19(25)22-11)6-5-13-9-23(10-16(13)18)17(24)8-12-3-2-4-14(20)7-12/h2-4,7,13,16H,5-6,8-10H2,1H3,(H,21,22,25)/t13-,16+/m1/s1 |
| InChIKey | NSDHQXXIQDLLIG-CJNGLKHVSA-N |
| XLogP | 1.95 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |