C17H18N4O2 — CID 136681982
2-[3-[[(2S)-oxolan-2-yl]methylamino]imidazo[1,2-a]pyrazin-2-yl]phenol (PubChem CID 136681982) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 2-[3-[[(2S)-oxolan-2-yl]methylamino]imidazo[1,2-a]pyrazin-2-yl]phenol.
| Compound Name | 2-[3-[[(2S)-oxolan-2-yl]methylamino]imidazo[1,2-a]pyrazin-2-yl]phenol |
|---|---|
| PubChem CID | 136681982 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-[3-[[(2S)-oxolan-2-yl]methylamino]imidazo[1,2-a]pyrazin-2-yl]phenol |
| SMILES | Oc1ccccc1-c1nc2cnccn2c1NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C17H18N4O2/c22-14-6-2-1-5-13(14)16-17(19-10-12-4-3-9-23-12)21-8-7-18-11-15(21)20-16/h1-2,5-8,11-12,19,22H,3-4,9-10H2/t12-/m0/s1 |
| InChIKey | SWIWSBCBJKWQMA-LBPRGKRZSA-N |
| XLogP | 2.69 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |