C21H22N4O — CID 136682160
4-[(2R)-1-benzylpiperidin-2-yl]-2-pyridin-4-yl-1H-pyrimidin-6-one (PubChem CID 136682160) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is 4-[(2R)-1-benzylpiperidin-2-yl]-2-pyridin-4-yl-1H-pyrimidin-6-one.
| Compound Name | 4-[(2R)-1-benzylpiperidin-2-yl]-2-pyridin-4-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136682160 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 4-[(2R)-1-benzylpiperidin-2-yl]-2-pyridin-4-yl-1H-pyrimidin-6-one |
| SMILES | O=c1cc([C@H]2CCCCN2Cc2ccccc2)nc(-c2ccncc2)[nH]1 |
| InChI | InChI=1S/C21H22N4O/c26-20-14-18(23-21(24-20)17-9-11-22-12-10-17)19-8-4-5-13-25(19)15-16-6-2-1-3-7-16/h1-3,6-7,9-12,14,19H,4-5,8,13,15H2,(H,23,24,26)/t19-/m1/s1 |
| InChIKey | ARGQKDOQZUJYHH-LJQANCHMSA-N |
| XLogP | 3.56 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |