C10H8Br2N2OS — CID 136683043
2-(4,5-dibromothiophen-2-yl)-4-ethyl-1H-pyrimidin-6-one (PubChem CID 136683043) has the molecular formula C10H8Br2N2OS and a molecular weight of 364.06 g/mol. Its IUPAC name is 2-(4,5-dibromothiophen-2-yl)-4-ethyl-1H-pyrimidin-6-one.
| Compound Name | 2-(4,5-dibromothiophen-2-yl)-4-ethyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136683043 |
| Molecular Formula | C10H8Br2N2OS |
| Molecular Weight | 364.06 g/mol |
| Exact Mass | 361.87 |
| IUPAC Name | 2-(4,5-dibromothiophen-2-yl)-4-ethyl-1H-pyrimidin-6-one |
| SMILES | CCc1cc(=O)[nH]c(-c2cc(Br)c(Br)s2)n1 |
| InChI | InChI=1S/C10H8Br2N2OS/c1-2-5-3-8(15)14-10(13-5)7-4-6(11)9(12)16-7/h3-4H,2H2,1H3,(H,13,14,15) |
| InChIKey | LHSJMUBUXCZKHD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.06 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |