About 2-(2-methylpropylsulfanyl)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one
2-(2-methylpropylsulfanyl)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one (PubChem CID 136683960) has the molecular formula C10H14N2OS2
and a molecular weight of 242.37 g/mol. Its IUPAC name is 2-(2-methylpropylsulfanyl)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-(2-methylpropylsulfanyl)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one |
| PubChem CID | 136683960 |
| Molecular Formula | C10H14N2OS2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 2-(2-methylpropylsulfanyl)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one |
| SMILES | CC(C)CSc1nc2c(c(=O)[nH]1)CSC2 |
| InChI | InChI=1S/C10H14N2OS2/c1-6(2)3-15-10-11-8-5-14-4-7(8)9(13)12-10/h6H,3-5H2,1-2H3,(H,11,12,13) |
| InChIKey | XYYLYTCHUVCICK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-methylpropylsulfanyl)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylpropylsulfanyl)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one?
The IUPAC name of 2-(2-methylpropylsulfanyl)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one (CID 136683960) is 2-(2-methylpropylsulfanyl)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one.
What is the SMILES notation for 2-(2-methylpropylsulfanyl)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one?
The canonical SMILES for 2-(2-methylpropylsulfanyl)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one is CC(C)CSc1nc2c(c(=O)[nH]1)CSC2.
What is the InChIKey of 2-(2-methylpropylsulfanyl)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one?
The InChIKey is XYYLYTCHUVCICK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2OS2/c1-6(2)3-15-10-11-8-5-14-4-7(8)9(13)12-10/h6H,3-5H2,1-2H3,(H,11,12,13).
What are the key properties of 2-(2-methylpropylsulfanyl)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one?
2-(2-methylpropylsulfanyl)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one has a molecular weight of 242.37 g/mol, XLogP of 2.26, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylpropylsulfanyl)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one is sourced from PubChem (CID 136683960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).