About [(7-methoxy-2,3-dihydrochromen-4-ylidene)amino] 2-iodobenzoate
[(7-methoxy-2,3-dihydrochromen-4-ylidene)amino] 2-iodobenzoate (PubChem CID 1366843) has the molecular formula C17H14INO4
and a molecular weight of 423.21 g/mol. Its IUPAC name is [(7-methoxy-2,3-dihydrochromen-4-ylidene)amino] 2-iodobenzoate.
Molecular Properties
| Compound Name | [(7-methoxy-2,3-dihydrochromen-4-ylidene)amino] 2-iodobenzoate |
| PubChem CID | 1366843 |
| Molecular Formula | C17H14INO4 |
| Molecular Weight | 423.21 g/mol |
| Exact Mass | 423.00 |
| IUPAC Name | [(7-methoxy-2,3-dihydrochromen-4-ylidene)amino] 2-iodobenzoate |
| SMILES | COc1ccc2c(c1)OCCC2=NOC(=O)c1ccccc1I |
| InChI | InChI=1S/C17H14INO4/c1-21-11-6-7-13-15(8-9-22-16(13)10-11)19-23-17(20)12-4-2-3-5-14(12)18/h2-7,10H,8-9H2,1H3 |
| InChIKey | GJXUMXDGKLBMIG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.21 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(7-methoxy-2,3-dihydrochromen-4-ylidene)amino] 2-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(7-methoxy-2,3-dihydrochromen-4-ylidene)amino] 2-iodobenzoate?
The IUPAC name of [(7-methoxy-2,3-dihydrochromen-4-ylidene)amino] 2-iodobenzoate (CID 1366843) is [(7-methoxy-2,3-dihydrochromen-4-ylidene)amino] 2-iodobenzoate.
What is the SMILES notation for [(7-methoxy-2,3-dihydrochromen-4-ylidene)amino] 2-iodobenzoate?
The canonical SMILES for [(7-methoxy-2,3-dihydrochromen-4-ylidene)amino] 2-iodobenzoate is COc1ccc2c(c1)OCCC2=NOC(=O)c1ccccc1I.
What is the InChIKey of [(7-methoxy-2,3-dihydrochromen-4-ylidene)amino] 2-iodobenzoate?
The InChIKey is GJXUMXDGKLBMIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14INO4/c1-21-11-6-7-13-15(8-9-22-16(13)10-11)19-23-17(20)12-4-2-3-5-14(12)18/h2-7,10H,8-9H2,1H3.
What are the key properties of [(7-methoxy-2,3-dihydrochromen-4-ylidene)amino] 2-iodobenzoate?
[(7-methoxy-2,3-dihydrochromen-4-ylidene)amino] 2-iodobenzoate has a molecular weight of 423.21 g/mol, XLogP of 3.64, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(7-methoxy-2,3-dihydrochromen-4-ylidene)amino] 2-iodobenzoate is sourced from PubChem (CID 1366843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).