C18H22ClN3O3S — CID 136685167
2-[(4-butyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(3-chloro-4-methoxyphenyl)propanamide (PubChem CID 136685167) has the molecular formula C18H22ClN3O3S and a molecular weight of 395.91 g/mol. Its IUPAC name is 2-[(4-butyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(3-chloro-4-methoxyphenyl)propanamide.
| Compound Name | 2-[(4-butyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(3-chloro-4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 136685167 |
| Molecular Formula | C18H22ClN3O3S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 2-[(4-butyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(3-chloro-4-methoxyphenyl)propanamide |
| SMILES | CCCCc1cc(=O)[nH]c(SC(C)C(=O)Nc2ccc(OC)c(Cl)c2)n1 |
| InChI | InChI=1S/C18H22ClN3O3S/c1-4-5-6-12-10-16(23)22-18(21-12)26-11(2)17(24)20-13-7-8-15(25-3)14(19)9-13/h7-11H,4-6H2,1-3H3,(H,20,24)(H,21,22,23) |
| InChIKey | ISRXLQFYXCJZMS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |