C21H21N3O3S — CID 136685660
2-[[4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(4-methylphenyl)propanamide (PubChem CID 136685660) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is 2-[[4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(4-methylphenyl)propanamide.
| Compound Name | 2-[[4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 136685660 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 2-[[4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(4-methylphenyl)propanamide |
| SMILES | COc1ccc(-c2cc(=O)[nH]c(SC(C)C(=O)Nc3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C21H21N3O3S/c1-13-4-8-16(9-5-13)22-20(26)14(2)28-21-23-18(12-19(25)24-21)15-6-10-17(27-3)11-7-15/h4-12,14H,1-3H3,(H,22,26)(H,23,24,25) |
| InChIKey | KIVMYXIJDPPWDE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |