C15H17N3O2S2 — CID 136686496
2-[[4-(ethylsulfanylmethyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-phenylacetamide (PubChem CID 136686496) has the molecular formula C15H17N3O2S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-[[4-(ethylsulfanylmethyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-phenylacetamide.
| Compound Name | 2-[[4-(ethylsulfanylmethyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 136686496 |
| Molecular Formula | C15H17N3O2S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 2-[[4-(ethylsulfanylmethyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-phenylacetamide |
| SMILES | CCSCc1cc(=O)[nH]c(SCC(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C15H17N3O2S2/c1-2-21-9-12-8-13(19)18-15(17-12)22-10-14(20)16-11-6-4-3-5-7-11/h3-8H,2,9-10H2,1H3,(H,16,20)(H,17,18,19) |
| InChIKey | WZGGMZWHLCRQNM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |