C7H7F3N4O2 — CID 136687988
7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid (PubChem CID 136687988) has the molecular formula C7H7F3N4O2 and a molecular weight of 236.15 g/mol. Its IUPAC name is 7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid.
| Compound Name | 7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid |
|---|---|
| PubChem CID | 136687988 |
| Molecular Formula | C7H7F3N4O2 |
| Molecular Weight | 236.15 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 7-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid |
| SMILES | O=C(O)c1nc2n(n1)C(C(F)(F)F)CCN2 |
| InChI | InChI=1S/C7H7F3N4O2/c8-7(9,10)3-1-2-11-6-12-4(5(15)16)13-14(3)6/h3H,1-2H2,(H,15,16)(H,11,12,13) |
| InChIKey | RZIGZVNEEMURKG-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.15 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |