C27H24N4O3 — CID 136688942
(9S,11S)-9,11-bis(2-methoxyphenyl)-14-methyl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene (PubChem CID 136688942) has the molecular formula C27H24N4O3 and a molecular weight of 452.51 g/mol. Its IUPAC name is (9S,11S)-9,11-bis(2-methoxyphenyl)-14-methyl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene.
| Compound Name | (9S,11S)-9,11-bis(2-methoxyphenyl)-14-methyl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
|---|---|
| PubChem CID | 136688942 |
| Molecular Formula | C27H24N4O3 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | (9S,11S)-9,11-bis(2-methoxyphenyl)-14-methyl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
| SMILES | COc1ccccc1[C@H]1Oc2ccccc2C2=C1[C@@H](c1ccccc1OC)n1nc(C)nc1N2 |
| InChI | InChI=1S/C27H24N4O3/c1-16-28-27-29-24-17-10-4-9-15-22(17)34-26(19-12-6-8-14-21(19)33-3)23(24)25(31(27)30-16)18-11-5-7-13-20(18)32-2/h4-15,25-26H,1-3H3,(H,28,29,30)/t25-,26-/m1/s1 |
| InChIKey | MKOVFPFRTMCFQZ-CLJLJLNGSA-N |
| XLogP | 5.16 |
| TPSA | 70.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |