C20H19ClN4O2 — CID 136689254
1-[[2-(3-chlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylidene]-3-(2,3-dimethylphenyl)urea (PubChem CID 136689254) has the molecular formula C20H19ClN4O2 and a molecular weight of 382.85 g/mol. Its IUPAC name is 1-[[2-(3-chlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylidene]-3-(2,3-dimethylphenyl)urea.
| Compound Name | 1-[[2-(3-chlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylidene]-3-(2,3-dimethylphenyl)urea |
|---|---|
| PubChem CID | 136689254 |
| Molecular Formula | C20H19ClN4O2 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 1-[[2-(3-chlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylidene]-3-(2,3-dimethylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)N=Cc2c(C)[nH]n(-c3cccc(Cl)c3)c2=O)c1C |
| InChI | InChI=1S/C20H19ClN4O2/c1-12-6-4-9-18(13(12)2)23-20(27)22-11-17-14(3)24-25(19(17)26)16-8-5-7-15(21)10-16/h4-11,24H,1-3H3,(H,23,27) |
| InChIKey | JCLBPAZFBKFEKN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|