C8H12N4O — CID 136690169
(6S)-2,6-diamino-5,6,7,8-tetrahydro-3H-quinazolin-4-one (PubChem CID 136690169) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is (6S)-2,6-diamino-5,6,7,8-tetrahydro-3H-quinazolin-4-one.
| Compound Name | (6S)-2,6-diamino-5,6,7,8-tetrahydro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136690169 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | (6S)-2,6-diamino-5,6,7,8-tetrahydro-3H-quinazolin-4-one |
| SMILES | Nc1nc2c(c(=O)[nH]1)C[C@@H](N)CC2 |
| InChI | InChI=1S/C8H12N4O/c9-4-1-2-6-5(3-4)7(13)12-8(10)11-6/h4H,1-3,9H2,(H3,10,11,12,13)/t4-/m0/s1 |
| InChIKey | MKWLSOULKFHRCB-BYPYZUCNSA-N |
| XLogP | -0.83 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |