C9H14N4OS — CID 136690772
4,6-dimethyl-N-(1,2,4-oxadiazol-3-ylmethyl)-1,3-thiazinan-2-imine (PubChem CID 136690772) has the molecular formula C9H14N4OS and a molecular weight of 226.30 g/mol. Its IUPAC name is 4,6-dimethyl-N-(1,2,4-oxadiazol-3-ylmethyl)-1,3-thiazinan-2-imine.
| Compound Name | 4,6-dimethyl-N-(1,2,4-oxadiazol-3-ylmethyl)-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136690772 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 4,6-dimethyl-N-(1,2,4-oxadiazol-3-ylmethyl)-1,3-thiazinan-2-imine |
| SMILES | CC1CC(C)S/C(=N\Cc2ncon2)N1 |
| InChI | InChI=1S/C9H14N4OS/c1-6-3-7(2)15-9(12-6)10-4-8-11-5-14-13-8/h5-7H,3-4H2,1-2H3,(H,10,12) |
| InChIKey | NKFNXZCHPAGJFY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|