C43H26Cl3N5 — CID 136690981
5,10,15-tris(4-chlorophenyl)-20-pyridin-4-yl-21,23-dihydroporphyrin (PubChem CID 136690981) has the molecular formula C43H26Cl3N5 and a molecular weight of 719.08 g/mol. Its IUPAC name is 5,10,15-tris(4-chlorophenyl)-20-pyridin-4-yl-21,23-dihydroporphyrin.
| Compound Name | 5,10,15-tris(4-chlorophenyl)-20-pyridin-4-yl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136690981 |
| Molecular Formula | C43H26Cl3N5 |
| Molecular Weight | 719.08 g/mol |
| Exact Mass | 717.13 |
| IUPAC Name | 5,10,15-tris(4-chlorophenyl)-20-pyridin-4-yl-21,23-dihydroporphyrin |
| SMILES | Clc1ccc(-c2c3nc(c(-c4ccc(Cl)cc4)c4ccc([nH]4)c(-c4ccc(Cl)cc4)c4nc(c(-c5ccncc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C43H26Cl3N5/c44-29-7-1-25(2-8-29)40-32-13-15-34(48-32)41(26-3-9-30(45)10-4-26)36-17-19-38(50-36)43(28-21-23-47-24-22-28)39-20-18-37(51-39)42(35-16-14-33(40)49-35)27-5-11-31(46)12-6-27/h1-24,48,51H/b40-32-,40-33-,41-34-,41-36-,42-35-,42-37-,43-38-,43-39- |
| InChIKey | WHOPQWDKPNXFRR-GBQNNRHKSA-N |
| XLogP | 12.68 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.08 |
| LogP ≤ 5 | 12.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |