C14H13N3O — CID 136691181
5-(indol-3-ylidenemethyl)-2,3-dimethylimidazol-4-ol (PubChem CID 136691181) has the molecular formula C14H13N3O and a molecular weight of 239.28 g/mol. Its IUPAC name is 5-(indol-3-ylidenemethyl)-2,3-dimethylimidazol-4-ol.
| Compound Name | 5-(indol-3-ylidenemethyl)-2,3-dimethylimidazol-4-ol |
|---|---|
| PubChem CID | 136691181 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 5-(indol-3-ylidenemethyl)-2,3-dimethylimidazol-4-ol |
| SMILES | Cc1nc(C=C2C=Nc3ccccc32)c(O)n1C |
| InChI | InChI=1S/C14H13N3O/c1-9-16-13(14(18)17(9)2)7-10-8-15-12-6-4-3-5-11(10)12/h3-8,18H,1-2H3 |
| InChIKey | FDDJOFYCXYELQV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |