C11H10FN3O — CID 136692266
4-(5-fluoro-3-pyridinyl)-2,5-dimethyl-1H-pyrimidin-6-one (PubChem CID 136692266) has the molecular formula C11H10FN3O and a molecular weight of 219.22 g/mol. Its IUPAC name is 4-(5-fluoro-3-pyridinyl)-2,5-dimethyl-1H-pyrimidin-6-one.
| Compound Name | 4-(5-fluoro-3-pyridinyl)-2,5-dimethyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136692266 |
| Molecular Formula | C11H10FN3O |
| Molecular Weight | 219.22 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 4-(5-fluoro-3-pyridinyl)-2,5-dimethyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(-c2cncc(F)c2)c(C)c(=O)[nH]1 |
| InChI | InChI=1S/C11H10FN3O/c1-6-10(14-7(2)15-11(6)16)8-3-9(12)5-13-4-8/h3-5H,1-2H3,(H,14,15,16) |
| InChIKey | LWAOANWPLAWVGP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |