C22H29N3O4 — CID 136693012
1-benzyl-6-hydroxy-5-[[(1S,5S)-5-hydroxy-1,3,3-trimethylcyclohexyl]methyliminomethyl]pyrimidine-2,4-dione (PubChem CID 136693012) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is 1-benzyl-6-hydroxy-5-[[(1S,5S)-5-hydroxy-1,3,3-trimethylcyclohexyl]methyliminomethyl]pyrimidine-2,4-dione.
| Compound Name | 1-benzyl-6-hydroxy-5-[[(1S,5S)-5-hydroxy-1,3,3-trimethylcyclohexyl]methyliminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 136693012 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 1-benzyl-6-hydroxy-5-[[(1S,5S)-5-hydroxy-1,3,3-trimethylcyclohexyl]methyliminomethyl]pyrimidine-2,4-dione |
| SMILES | CC1(C)C[C@H](O)C[C@@](C)(C/N=C/c2c(O)n(Cc3ccccc3)c(=O)[nH]c2=O)C1 |
| InChI | InChI=1S/C22H29N3O4/c1-21(2)9-16(26)10-22(3,13-21)14-23-11-17-18(27)24-20(29)25(19(17)28)12-15-7-5-4-6-8-15/h4-8,11,16,26,28H,9-10,12-14H2,1-3H3,(H,24,27,29)/b23-11+/t16-,22+/m0/s1 |
| InChIKey | LDYSITNHJCNQRI-BFIMBRLJSA-N |
| XLogP | 2.29 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|