C10H16N4OS — CID 136693086
4-amino-2-(2-aminocyclohexyl)sulfanyl-1H-pyrimidin-6-one (PubChem CID 136693086) has the molecular formula C10H16N4OS and a molecular weight of 240.33 g/mol. Its IUPAC name is 4-amino-2-(2-aminocyclohexyl)sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-(2-aminocyclohexyl)sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136693086 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4-amino-2-(2-aminocyclohexyl)sulfanyl-1H-pyrimidin-6-one |
| SMILES | Nc1cc(=O)[nH]c(SC2CCCCC2N)n1 |
| InChI | InChI=1S/C10H16N4OS/c11-6-3-1-2-4-7(6)16-10-13-8(12)5-9(15)14-10/h5-7H,1-4,11H2,(H3,12,13,14,15) |
| InChIKey | AXKVQVRNRDYVIU-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |