About CID 136693288
CID 136693288 (PubChem CID 136693288) has the molecular formula C42H126O37Si38
and a molecular weight of 2290.70 g/mol.
Molecular Properties
| Compound Name | CID 136693288 |
| PubChem CID | 136693288 |
| Molecular Formula | C42H126O37Si38 |
| Molecular Weight | 2290.70 g/mol |
| Exact Mass | 2285.92 |
| IUPAC Name | — |
| SMILES | C[Si](O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)(C)C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)(C)C |
| InChI | InChI=1S/C42H126O37Si38/c1-80(44-82(3)46-84(5)48-86(7)50-88(9)52-90(11)54-92(13)56-94(15)58-96(17)60-98(19)62-100(21)64-102(23)66-104(25)68-106(27)70-108(29)72-110(31)74-112(33)76-114(35)78-116(37,38)39)43-81(2)45-83(4)47-85(6)49-87(8)51-89(10)53-91(12)55-93(14)57-95(16)59-97(18)61-99(20)63-101(22)65-103(24)67-105(26)69-107(28)71-109(30)73-111(32)75-113(34)77-115(36)79-117(40,41)42/h1-42H3 |
| InChIKey | AFLGIOFKROCWSJ-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 341.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 37 |
| Rotatable Bonds | 74 |
| Heavy Atoms | 117 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 2290.70 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 37 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 136693288 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136693288?
The IUPAC name of CID 136693288 (CID 136693288) is not available.
What is the SMILES notation for CID 136693288?
The canonical SMILES for CID 136693288 is C[Si](O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)(C)C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)O[Si](C)(C)C.
What is the InChIKey of CID 136693288?
The InChIKey is AFLGIOFKROCWSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H126O37Si38/c1-80(44-82(3)46-84(5)48-86(7)50-88(9)52-90(11)54-92(13)56-94(15)58-96(17)60-98(19)62-100(21)64-102(23)66-104(25)68-106(27)70-108(29)72-110(31)74-112(33)76-114(35)78-116(37,38)39)43-81(2)45-83(4)47-85(6)49-87(8)51-89(10)53-91(12)55-93(14)57-95(16)59-97(18)61-99(20)63-101(22)65-103(24)67-105(26)69-107(28)71-109(30)73-111(32)75-113(34)77-115(36)79-117(40,41)42/h1-42H3.
What are the key properties of CID 136693288?
CID 136693288 has a molecular weight of 2290.70 g/mol, XLogP of 7.52, 74 rotatable bonds, 0 hydrogen bond donors, and 37 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136693288 is sourced from PubChem (CID 136693288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).